C34H37F3O7 — CID 137419496
[4-[(4-hexylphenoxy)-hydroxymethyl]-2-(trifluoromethyl)phenyl] 4-(4-prop-2-enoyloxybutoxy)benzoate (PubChem CID 137419496) has the molecular formula C34H37F3O7 and a molecular weight of 614.66 g/mol. Its IUPAC name is [4-[(4-hexylphenoxy)-hydroxymethyl]-2-(trifluoromethyl)phenyl] 4-(4-prop-2-enoyloxybutoxy)benzoate.
| Compound Name | [4-[(4-hexylphenoxy)-hydroxymethyl]-2-(trifluoromethyl)phenyl] 4-(4-prop-2-enoyloxybutoxy)benzoate |
|---|---|
| PubChem CID | 137419496 |
| Molecular Formula | C34H37F3O7 |
| Molecular Weight | 614.66 g/mol |
| Exact Mass | 614.25 |
| IUPAC Name | [4-[(4-hexylphenoxy)-hydroxymethyl]-2-(trifluoromethyl)phenyl] 4-(4-prop-2-enoyloxybutoxy)benzoate |
| SMILES | C=CC(=O)OCCCCOc1ccc(C(=O)Oc2ccc(C(O)Oc3ccc(CCCCCC)cc3)cc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C34H37F3O7/c1-3-5-6-7-10-24-11-16-28(17-12-24)43-33(40)26-15-20-30(29(23-26)34(35,36)37)44-32(39)25-13-18-27(19-14-25)41-21-8-9-22-42-31(38)4-2/h4,11-20,23,33,40H,2-3,5-10,21-22H2,1H3 |
| InChIKey | JVPWMDXPMAMRDL-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.66 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|