C46H54N2O7S — CID 145312768
[2-[(Z)-3-(1,3-benzothiazol-2-ylamino)-2-methylbut-1-enyl]-4-(4-propylcyclohexyl)phenyl] 4-[5,6-di(prop-2-enoyloxy)hexoxy]benzoate (PubChem CID 145312768) has the molecular formula C46H54N2O7S and a molecular weight of 779.01 g/mol. Its IUPAC name is [2-[(Z)-3-(1,3-benzothiazol-2-ylamino)-2-methylbut-1-enyl]-4-(4-propylcyclohexyl)phenyl] 4-[5,6-di(prop-2-enoyloxy)hexoxy]benzoate.
| Compound Name | [2-[(Z)-3-(1,3-benzothiazol-2-ylamino)-2-methylbut-1-enyl]-4-(4-propylcyclohexyl)phenyl] 4-[5,6-di(prop-2-enoyloxy)hexoxy]benzoate |
|---|---|
| PubChem CID | 145312768 |
| Molecular Formula | C46H54N2O7S |
| Molecular Weight | 779.01 g/mol |
| Exact Mass | 778.37 |
| IUPAC Name | [2-[(Z)-3-(1,3-benzothiazol-2-ylamino)-2-methylbut-1-enyl]-4-(4-propylcyclohexyl)phenyl] 4-[5,6-di(prop-2-enoyloxy)hexoxy]benzoate |
| SMILES | C=CC(=O)OCC(CCCCOc1ccc(C(=O)Oc2ccc(C3CCC(CCC)CC3)cc2/C=C(/C)C(C)Nc2nc3ccccc3s2)cc1)OC(=O)C=C |
| InChI | InChI=1S/C46H54N2O7S/c1-6-13-33-17-19-34(20-18-33)36-23-26-41(37(29-36)28-31(4)32(5)47-46-48-40-15-9-10-16-42(40)56-46)55-45(51)35-21-24-38(25-22-35)52-27-12-11-14-39(54-44(50)8-3)30-53-43(49)7-2/h7-10,15-16,21-26,28-29,32-34,39H,2-3,6,11-14,17-20,27,30H2,1,4-5H3,(H,47,48)/b31-28- |
| InChIKey | UPIVHAKHEIRQSA-PNOGMODKSA-N |
| XLogP | 10.87 |
| TPSA | 113.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.01 |
| LogP ≤ 5 | 10.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|