C53H68O13 — CID 167130964
[4-(6-propanoyloxyhexoxy)phenyl] 4-[[3-formyl-4-[[4-[4-(6-prop-2-enoyloxyhexoxy)phenoxy]carbonylcyclohexyl]methoxy]phenoxy]methyl]cyclohexane-1-carboxylate (PubChem CID 167130964) has the molecular formula C53H68O13 and a molecular weight of 913.11 g/mol. Its IUPAC name is [4-(6-propanoyloxyhexoxy)phenyl] 4-[[3-formyl-4-[[4-[4-(6-prop-2-enoyloxyhexoxy)phenoxy]carbonylcyclohexyl]methoxy]phenoxy]methyl]cyclohexane-1-carboxylate.
| Compound Name | [4-(6-propanoyloxyhexoxy)phenyl] 4-[[3-formyl-4-[[4-[4-(6-prop-2-enoyloxyhexoxy)phenoxy]carbonylcyclohexyl]methoxy]phenoxy]methyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 167130964 |
| Molecular Formula | C53H68O13 |
| Molecular Weight | 913.11 g/mol |
| Exact Mass | 912.47 |
| IUPAC Name | [4-(6-propanoyloxyhexoxy)phenyl] 4-[[3-formyl-4-[[4-[4-(6-prop-2-enoyloxyhexoxy)phenoxy]carbonylcyclohexyl]methoxy]phenoxy]methyl]cyclohexane-1-carboxylate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(OC(=O)C2CCC(COc3ccc(OCC4CCC(C(=O)Oc5ccc(OCCCCCCOC(=O)CC)cc5)CC4)cc3C=O)CC2)cc1 |
| InChI | InChI=1S/C53H68O13/c1-3-50(55)61-33-11-7-5-9-31-59-44-21-25-46(26-22-44)65-52(57)41-17-13-39(14-18-41)37-63-48-29-30-49(43(35-48)36-54)64-38-40-15-19-42(20-16-40)53(58)66-47-27-23-45(24-28-47)60-32-10-6-8-12-34-62-51(56)4-2/h4,21-30,35-36,39-42H,2-3,5-20,31-34,37-38H2,1H3 |
| InChIKey | AFIZHWDBAMCPJJ-UHFFFAOYSA-N |
| XLogP | 10.64 |
| TPSA | 159.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 913.11 |
| LogP ≤ 5 | 10.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|