C39H45NO7 — CID 142383926
[4-[cyclobutylidene-[4-[3-methyl-2-(prop-2-enoyloxymethyl)pentoxy]phenyl]methoxy]-3-methanimidoylphenyl] 4-[(2-methylpropan-2-yl)oxy]benzoate (PubChem CID 142383926) has the molecular formula C39H45NO7 and a molecular weight of 639.79 g/mol. Its IUPAC name is [4-[cyclobutylidene-[4-[3-methyl-2-(prop-2-enoyloxymethyl)pentoxy]phenyl]methoxy]-3-methanimidoylphenyl] 4-[(2-methylpropan-2-yl)oxy]benzoate.
| Compound Name | [4-[cyclobutylidene-[4-[3-methyl-2-(prop-2-enoyloxymethyl)pentoxy]phenyl]methoxy]-3-methanimidoylphenyl] 4-[(2-methylpropan-2-yl)oxy]benzoate |
|---|---|
| PubChem CID | 142383926 |
| Molecular Formula | C39H45NO7 |
| Molecular Weight | 639.79 g/mol |
| Exact Mass | 639.32 |
| IUPAC Name | [4-[cyclobutylidene-[4-[3-methyl-2-(prop-2-enoyloxymethyl)pentoxy]phenyl]methoxy]-3-methanimidoylphenyl] 4-[(2-methylpropan-2-yl)oxy]benzoate |
| SMILES | [H]/N=C/c1cc(OC(=O)c2ccc(OC(C)(C)C)cc2)ccc1OC(=C1CCC1)c1ccc(OCC(COC(=O)C=C)C(C)CC)cc1 |
| InChI | InChI=1S/C39H45NO7/c1-7-26(3)31(25-44-36(41)8-2)24-43-32-16-12-28(13-17-32)37(27-10-9-11-27)46-35-21-20-34(22-30(35)23-40)45-38(42)29-14-18-33(19-15-29)47-39(4,5)6/h8,12-23,26,31,40H,2,7,9-11,24-25H2,1,3-6H3/b40-23+ |
| InChIKey | YNQJRFRXUHIWET-ZXTCRCEHSA-N |
| XLogP | 8.83 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.79 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|