C39H44NO10+ — CID 145121828
[2-[4-[5,6-di(prop-2-enoyloxy)hexoxy]benzoyl]oxy-5-[2-[4-[(2-methylpropan-2-yl)oxy]benzoyl]oxyethyl]phenyl]methylideneazanium (PubChem CID 145121828) has the molecular formula C39H44NO10+ and a molecular weight of 686.78 g/mol. Its IUPAC name is [2-[4-[5,6-di(prop-2-enoyloxy)hexoxy]benzoyl]oxy-5-[2-[4-[(2-methylpropan-2-yl)oxy]benzoyl]oxyethyl]phenyl]methylideneazanium.
| Compound Name | [2-[4-[5,6-di(prop-2-enoyloxy)hexoxy]benzoyl]oxy-5-[2-[4-[(2-methylpropan-2-yl)oxy]benzoyl]oxyethyl]phenyl]methylideneazanium |
|---|---|
| PubChem CID | 145121828 |
| Molecular Formula | C39H44NO10+ |
| Molecular Weight | 686.78 g/mol |
| Exact Mass | 686.30 |
| IUPAC Name | [2-[4-[5,6-di(prop-2-enoyloxy)hexoxy]benzoyl]oxy-5-[2-[4-[(2-methylpropan-2-yl)oxy]benzoyl]oxyethyl]phenyl]methylideneazanium |
| SMILES | C=CC(=O)OCC(CCCCOc1ccc(C(=O)Oc2ccc(CCOC(=O)c3ccc(OC(C)(C)C)cc3)cc2C=[NH2+])cc1)OC(=O)C=C |
| InChI | InChI=1S/C39H43NO10/c1-6-35(41)47-26-33(48-36(42)7-2)10-8-9-22-45-31-16-12-29(13-17-31)38(44)49-34-20-11-27(24-30(34)25-40)21-23-46-37(43)28-14-18-32(19-15-28)50-39(3,4)5/h6-7,11-20,24-25,33,40H,1-2,8-10,21-23,26H2,3-5H3/p+1 |
| InChIKey | CQOOPYKGSSUGKM-UHFFFAOYSA-O |
| XLogP | 5.04 |
| TPSA | 149.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.78 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|