C43H41N3O9S — CID 142383987
[2-[[2-(1,3-benzothiazol-2-yl)hydrazinyl]methyl]-4-[2-(4-methoxyphenyl)ethynyl]phenyl] 4-[2-prop-2-enoyloxy-3-(4-prop-2-enoyloxybutoxy)propoxy]benzoate (PubChem CID 142383987) has the molecular formula C43H41N3O9S and a molecular weight of 775.88 g/mol. Its IUPAC name is [2-[[2-(1,3-benzothiazol-2-yl)hydrazinyl]methyl]-4-[2-(4-methoxyphenyl)ethynyl]phenyl] 4-[2-prop-2-enoyloxy-3-(4-prop-2-enoyloxybutoxy)propoxy]benzoate.
| Compound Name | [2-[[2-(1,3-benzothiazol-2-yl)hydrazinyl]methyl]-4-[2-(4-methoxyphenyl)ethynyl]phenyl] 4-[2-prop-2-enoyloxy-3-(4-prop-2-enoyloxybutoxy)propoxy]benzoate |
|---|---|
| PubChem CID | 142383987 |
| Molecular Formula | C43H41N3O9S |
| Molecular Weight | 775.88 g/mol |
| Exact Mass | 775.26 |
| IUPAC Name | [2-[[2-(1,3-benzothiazol-2-yl)hydrazinyl]methyl]-4-[2-(4-methoxyphenyl)ethynyl]phenyl] 4-[2-prop-2-enoyloxy-3-(4-prop-2-enoyloxybutoxy)propoxy]benzoate |
| SMILES | C=CC(=O)OCCCCOCC(COc1ccc(C(=O)Oc2ccc(C#Cc3ccc(OC)cc3)cc2CNNc2nc3ccccc3s2)cc1)OC(=O)C=C |
| InChI | InChI=1S/C43H41N3O9S/c1-4-40(47)52-25-9-8-24-51-28-36(54-41(48)5-2)29-53-35-21-17-32(18-22-35)42(49)55-38-23-16-31(13-12-30-14-19-34(50-3)20-15-30)26-33(38)27-44-46-43-45-37-10-6-7-11-39(37)56-43/h4-7,10-11,14-23,26,36,44H,1-2,8-9,24-25,27-29H2,3H3,(H,45,46) |
| InChIKey | QMYDLIOUQUHHIQ-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 143.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.88 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|