C41H50O6 — CID 168867077
6-[4-[2-[4-(6-but-2-enoyloxyhexoxy)phenyl]-1,3-dihydroinden-2-yl]phenoxy]hexyl but-2-enoate (PubChem CID 168867077) has the molecular formula C41H50O6 and a molecular weight of 638.85 g/mol. Its IUPAC name is 6-[4-[2-[4-(6-but-2-enoyloxyhexoxy)phenyl]-1,3-dihydroinden-2-yl]phenoxy]hexyl but-2-enoate.
| Compound Name | 6-[4-[2-[4-(6-but-2-enoyloxyhexoxy)phenyl]-1,3-dihydroinden-2-yl]phenoxy]hexyl but-2-enoate |
|---|---|
| PubChem CID | 168867077 |
| Molecular Formula | C41H50O6 |
| Molecular Weight | 638.85 g/mol |
| Exact Mass | 638.36 |
| IUPAC Name | 6-[4-[2-[4-(6-but-2-enoyloxyhexoxy)phenyl]-1,3-dihydroinden-2-yl]phenoxy]hexyl but-2-enoate |
| SMILES | CC=CC(=O)OCCCCCCOc1ccc(C2(c3ccc(OCCCCCCOC(=O)C=CC)cc3)Cc3ccccc3C2)cc1 |
| InChI | InChI=1S/C41H50O6/c1-3-15-39(42)46-29-13-7-5-11-27-44-37-23-19-35(20-24-37)41(31-33-17-9-10-18-34(33)32-41)36-21-25-38(26-22-36)45-28-12-6-8-14-30-47-40(43)16-4-2/h3-4,9-10,15-26H,5-8,11-14,27-32H2,1-2H3 |
| InChIKey | VVRPHDXIZNRDSE-UHFFFAOYSA-N |
| XLogP | 8.89 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.85 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|