C20H28BO6 — CID 164999747
CID 164999747 (PubChem CID 164999747) has the molecular formula C20H28BO6 and a molecular weight of 375.25 g/mol.
| Compound Name | CID 164999747 |
|---|---|
| PubChem CID | 164999747 |
| Molecular Formula | C20H28BO6 |
| Molecular Weight | 375.25 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | — |
| SMILES | CC.Cc1ccccc1OCC(O)COC(=O)C1CC=CCC1C(=O)O.[B] |
| InChI | InChI=1S/C18H22O6.C2H6.B/c1-12-6-2-5-9-16(12)23-10-13(19)11-24-18(22)15-8-4-3-7-14(15)17(20)21;1-2;/h2-6,9,13-15,19H,7-8,10-11H2,1H3,(H,20,21);1-2H3; |
| InChIKey | FSYMCXITYBTZLJ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.25 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|