C34H32O6 — CID 68788216
1-[4-[9-[4-(2-hydroxypropoxy)phenyl]fluoren-9-yl]phenoxy]propan-2-ol;oxet-2-one (PubChem CID 68788216) has the molecular formula C34H32O6 and a molecular weight of 536.62 g/mol. Its IUPAC name is 1-[4-[9-[4-(2-hydroxypropoxy)phenyl]fluoren-9-yl]phenoxy]propan-2-ol;oxet-2-one.
| Compound Name | 1-[4-[9-[4-(2-hydroxypropoxy)phenyl]fluoren-9-yl]phenoxy]propan-2-ol;oxet-2-one |
|---|---|
| PubChem CID | 68788216 |
| Molecular Formula | C34H32O6 |
| Molecular Weight | 536.62 g/mol |
| Exact Mass | 536.22 |
| IUPAC Name | 1-[4-[9-[4-(2-hydroxypropoxy)phenyl]fluoren-9-yl]phenoxy]propan-2-ol;oxet-2-one |
| SMILES | CC(O)COc1ccc(C2(c3ccc(OCC(C)O)cc3)c3ccccc3-c3ccccc32)cc1.O=C1C=CO1 |
| InChI | InChI=1S/C31H30O4.C3H2O2/c1-21(32)19-34-25-15-11-23(12-16-25)31(24-13-17-26(18-14-24)35-20-22(2)33)29-9-5-3-7-27(29)28-8-4-6-10-30(28)31;4-3-1-2-5-3/h3-18,21-22,32-33H,19-20H2,1-2H3;1-2H |
| InChIKey | SYXXAVUXXFCPAF-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.62 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |