C31H28Cl2O4 — CID 68792294
1-[2-chloro-4-[9-[3-chloro-4-(2-hydroxypropoxy)phenyl]fluoren-9-yl]phenoxy]propan-2-ol (PubChem CID 68792294) has the molecular formula C31H28Cl2O4 and a molecular weight of 535.47 g/mol. Its IUPAC name is 1-[2-chloro-4-[9-[3-chloro-4-(2-hydroxypropoxy)phenyl]fluoren-9-yl]phenoxy]propan-2-ol.
| Compound Name | 1-[2-chloro-4-[9-[3-chloro-4-(2-hydroxypropoxy)phenyl]fluoren-9-yl]phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 68792294 |
| Molecular Formula | C31H28Cl2O4 |
| Molecular Weight | 535.47 g/mol |
| Exact Mass | 534.14 |
| IUPAC Name | 1-[2-chloro-4-[9-[3-chloro-4-(2-hydroxypropoxy)phenyl]fluoren-9-yl]phenoxy]propan-2-ol |
| SMILES | CC(O)COc1ccc(C2(c3ccc(OCC(C)O)c(Cl)c3)c3ccccc3-c3ccccc32)cc1Cl |
| InChI | InChI=1S/C31H28Cl2O4/c1-19(34)17-36-29-13-11-21(15-27(29)32)31(22-12-14-30(28(33)16-22)37-18-20(2)35)25-9-5-3-7-23(25)24-8-4-6-10-26(24)31/h3-16,19-20,34-35H,17-18H2,1-2H3 |
| InChIKey | AMMVUHISIHLWGV-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.47 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |