C70H76O8 — CID 158218728
1-[4-[9-[4-(2-hydroxypropoxy)-2,5-dimethylphenyl]fluoren-9-yl]-2,5-dimethylphenoxy]propan-2-ol (PubChem CID 158218728) has the molecular formula C70H76O8 and a molecular weight of 1045.37 g/mol. Its IUPAC name is 1-[4-[9-[4-(2-hydroxypropoxy)-2,5-dimethylphenyl]fluoren-9-yl]-2,5-dimethylphenoxy]propan-2-ol.
| Compound Name | 1-[4-[9-[4-(2-hydroxypropoxy)-2,5-dimethylphenyl]fluoren-9-yl]-2,5-dimethylphenoxy]propan-2-ol |
|---|---|
| PubChem CID | 158218728 |
| Molecular Formula | C70H76O8 |
| Molecular Weight | 1045.37 g/mol |
| Exact Mass | 1044.55 |
| IUPAC Name | 1-[4-[9-[4-(2-hydroxypropoxy)-2,5-dimethylphenyl]fluoren-9-yl]-2,5-dimethylphenoxy]propan-2-ol |
| SMILES | Cc1cc(C2(c3cc(C)c(OCC(C)O)cc3C)c3ccccc3-c3ccccc32)c(C)cc1OCC(C)O.Cc1cc(C2(c3cc(C)c(OCC(C)O)cc3C)c3ccccc3-c3ccccc32)c(C)cc1OCC(C)O |
| InChI | InChI=1S/2C35H38O4/c2*1-21-17-33(38-19-25(5)36)23(3)15-31(21)35(32-16-24(4)34(18-22(32)2)39-20-26(6)37)29-13-9-7-11-27(29)28-12-8-10-14-30(28)35/h2*7-18,25-26,36-37H,19-20H2,1-6H3 |
| InChIKey | GCZFWYZSAHZCBQ-UHFFFAOYSA-N |
| XLogP | 13.61 |
| TPSA | 117.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1045.37 |
| LogP ≤ 5 | 13.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |