C45H38O6 — CID 174977604
1-[4-[9-[4-(2-prop-2-enoyloxypropoxy)naphthalen-1-yl]fluoren-9-yl]naphthalen-1-yl]oxypropan-2-yl prop-2-enoate (PubChem CID 174977604) has the molecular formula C45H38O6 and a molecular weight of 674.79 g/mol. Its IUPAC name is 1-[4-[9-[4-(2-prop-2-enoyloxypropoxy)naphthalen-1-yl]fluoren-9-yl]naphthalen-1-yl]oxypropan-2-yl prop-2-enoate.
| Compound Name | 1-[4-[9-[4-(2-prop-2-enoyloxypropoxy)naphthalen-1-yl]fluoren-9-yl]naphthalen-1-yl]oxypropan-2-yl prop-2-enoate |
|---|---|
| PubChem CID | 174977604 |
| Molecular Formula | C45H38O6 |
| Molecular Weight | 674.79 g/mol |
| Exact Mass | 674.27 |
| IUPAC Name | 1-[4-[9-[4-(2-prop-2-enoyloxypropoxy)naphthalen-1-yl]fluoren-9-yl]naphthalen-1-yl]oxypropan-2-yl prop-2-enoate |
| SMILES | C=CC(=O)OC(C)COc1ccc(C2(c3ccc(OCC(C)OC(=O)C=C)c4ccccc34)c3ccccc3-c3ccccc32)c2ccccc12 |
| InChI | InChI=1S/C45H38O6/c1-5-43(46)50-29(3)27-48-41-25-23-39(33-17-7-9-19-35(33)41)45(37-21-13-11-15-31(37)32-16-12-14-22-38(32)45)40-24-26-42(36-20-10-8-18-34(36)40)49-28-30(4)51-44(47)6-2/h5-26,29-30H,1-2,27-28H2,3-4H3 |
| InChIKey | FULGXYKOVHPNPR-UHFFFAOYSA-N |
| XLogP | 9.35 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.79 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|