C27H25NO5 — CID 146339293
2-methyl-3,3-bis[4-(oxiran-2-ylmethoxy)phenyl]isoindol-1-one (PubChem CID 146339293) has the molecular formula C27H25NO5 and a molecular weight of 443.50 g/mol. Its IUPAC name is 2-methyl-3,3-bis[4-(oxiran-2-ylmethoxy)phenyl]isoindol-1-one.
| Compound Name | 2-methyl-3,3-bis[4-(oxiran-2-ylmethoxy)phenyl]isoindol-1-one |
|---|---|
| PubChem CID | 146339293 |
| Molecular Formula | C27H25NO5 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | 2-methyl-3,3-bis[4-(oxiran-2-ylmethoxy)phenyl]isoindol-1-one |
| SMILES | CN1C(=O)c2ccccc2C1(c1ccc(OCC2CO2)cc1)c1ccc(OCC2CO2)cc1 |
| InChI | InChI=1S/C27H25NO5/c1-28-26(29)24-4-2-3-5-25(24)27(28,18-6-10-20(11-7-18)30-14-22-16-32-22)19-8-12-21(13-9-19)31-15-23-17-33-23/h2-13,22-23H,14-17H2,1H3 |
| InChIKey | HEYNPSMMZYNAGQ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 63.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|