C30H34O4 — CID 146657004
2-[[4-[3,3-dimethyl-1-[(2E,4Z)-6-(oxiran-2-ylmethoxy)hepta-2,4,6-trien-3-yl]-2H-inden-1-yl]phenoxy]methyl]oxirane (PubChem CID 146657004) has the molecular formula C30H34O4 and a molecular weight of 458.60 g/mol. Its IUPAC name is 2-[[4-[3,3-dimethyl-1-[(2E,4Z)-6-(oxiran-2-ylmethoxy)hepta-2,4,6-trien-3-yl]-2H-inden-1-yl]phenoxy]methyl]oxirane.
| Compound Name | 2-[[4-[3,3-dimethyl-1-[(2E,4Z)-6-(oxiran-2-ylmethoxy)hepta-2,4,6-trien-3-yl]-2H-inden-1-yl]phenoxy]methyl]oxirane |
|---|---|
| PubChem CID | 146657004 |
| Molecular Formula | C30H34O4 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.25 |
| IUPAC Name | 2-[[4-[3,3-dimethyl-1-[(2E,4Z)-6-(oxiran-2-ylmethoxy)hepta-2,4,6-trien-3-yl]-2H-inden-1-yl]phenoxy]methyl]oxirane |
| SMILES | C=C(/C=C\C(=C/C)C1(c2ccc(OCC3CO3)cc2)CC(C)(C)c2ccccc21)OCC1CO1 |
| InChI | InChI=1S/C30H34O4/c1-5-22(11-10-21(2)31-16-25-18-33-25)30(20-29(3,4)27-8-6-7-9-28(27)30)23-12-14-24(15-13-23)32-17-26-19-34-26/h5-15,25-26H,2,16-20H2,1,3-4H3/b11-10-,22-5+ |
| InChIKey | HURWFOWSUFXOOA-BAGLTKMVSA-N |
| XLogP | 5.86 |
| TPSA | 43.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|