C38H36N2O7 — CID 102102939
6-(3-butoxyphenyl)-13-[5-(2-methylbutan-2-yl)-2-(oxiran-2-ylmethoxy)phenyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone (PubChem CID 102102939) has the molecular formula C38H36N2O7 and a molecular weight of 632.71 g/mol. Its IUPAC name is 6-(3-butoxyphenyl)-13-[5-(2-methylbutan-2-yl)-2-(oxiran-2-ylmethoxy)phenyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone.
| Compound Name | 6-(3-butoxyphenyl)-13-[5-(2-methylbutan-2-yl)-2-(oxiran-2-ylmethoxy)phenyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
|---|---|
| PubChem CID | 102102939 |
| Molecular Formula | C38H36N2O7 |
| Molecular Weight | 632.71 g/mol |
| Exact Mass | 632.25 |
| IUPAC Name | 6-(3-butoxyphenyl)-13-[5-(2-methylbutan-2-yl)-2-(oxiran-2-ylmethoxy)phenyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
| SMILES | CCCCOc1cccc(N2C(=O)c3ccc4c5c(ccc(c35)C2=O)C(=O)N(c2cc(C(C)(C)CC)ccc2OCC2CO2)C4=O)c1 |
| InChI | InChI=1S/C38H36N2O7/c1-5-7-17-45-24-10-8-9-23(19-24)39-34(41)26-12-14-28-33-29(15-13-27(32(26)33)35(39)42)37(44)40(36(28)43)30-18-22(38(3,4)6-2)11-16-31(30)47-21-25-20-46-25/h8-16,18-19,25H,5-7,17,20-21H2,1-4H3 |
| InChIKey | XTDWYRUTGZKGSW-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 105.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.71 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|