C22H18N2O8S — CID 162782642
bis[4-(oxiran-2-ylmethoxy)phenyl] 1,3,4-thiadiazole-2,5-dicarboxylate (PubChem CID 162782642) has the molecular formula C22H18N2O8S and a molecular weight of 470.46 g/mol. Its IUPAC name is bis[4-(oxiran-2-ylmethoxy)phenyl] 1,3,4-thiadiazole-2,5-dicarboxylate.
| Compound Name | bis[4-(oxiran-2-ylmethoxy)phenyl] 1,3,4-thiadiazole-2,5-dicarboxylate |
|---|---|
| PubChem CID | 162782642 |
| Molecular Formula | C22H18N2O8S |
| Molecular Weight | 470.46 g/mol |
| Exact Mass | 470.08 |
| IUPAC Name | bis[4-(oxiran-2-ylmethoxy)phenyl] 1,3,4-thiadiazole-2,5-dicarboxylate |
| SMILES | O=C(Oc1ccc(OCC2CO2)cc1)c1nnc(C(=O)Oc2ccc(OCC3CO3)cc2)s1 |
| InChI | InChI=1S/C22H18N2O8S/c25-21(31-15-5-1-13(2-6-15)27-9-17-11-29-17)19-23-24-20(33-19)22(26)32-16-7-3-14(4-8-16)28-10-18-12-30-18/h1-8,17-18H,9-12H2 |
| InChIKey | ZBZGHBNHLJVXAQ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 121.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.46 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|