C40H52O12 — CID 158769223
2-[[1-[2,4-bis[2-(oxiran-2-ylmethoxy)-3-phenoxypropoxy]phenoxy]-3-butoxypropan-2-yl]oxymethyl]oxirane (PubChem CID 158769223) has the molecular formula C40H52O12 and a molecular weight of 724.84 g/mol. Its IUPAC name is 2-[[1-[2,4-bis[2-(oxiran-2-ylmethoxy)-3-phenoxypropoxy]phenoxy]-3-butoxypropan-2-yl]oxymethyl]oxirane.
| Compound Name | 2-[[1-[2,4-bis[2-(oxiran-2-ylmethoxy)-3-phenoxypropoxy]phenoxy]-3-butoxypropan-2-yl]oxymethyl]oxirane |
|---|---|
| PubChem CID | 158769223 |
| Molecular Formula | C40H52O12 |
| Molecular Weight | 724.84 g/mol |
| Exact Mass | 724.35 |
| IUPAC Name | 2-[[1-[2,4-bis[2-(oxiran-2-ylmethoxy)-3-phenoxypropoxy]phenoxy]-3-butoxypropan-2-yl]oxymethyl]oxirane |
| SMILES | CCCCOCC(COc1ccc(OCC(COc2ccccc2)OCC2CO2)cc1OCC(COc1ccccc1)OCC1CO1)OCC1CO1 |
| InChI | InChI=1S/C40H52O12/c1-2-3-16-41-18-33(45-22-35-23-47-35)28-51-39-15-14-32(44-21-34(46-24-36-25-48-36)19-42-30-10-6-4-7-11-30)17-40(39)52-29-38(50-27-37-26-49-37)20-43-31-12-8-5-9-13-31/h4-15,17,33-38H,2-3,16,18-29H2,1H3 |
| InChIKey | IPQRCWRAJIFLPO-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 120.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.84 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|