C35H48O8 — CID 153495884
2-[[1-butoxy-3-[4-[2-[4-[3-but-2-ynoxy-2-(oxiran-2-ylmethoxy)propoxy]phenyl]propan-2-yl]phenoxy]propan-2-yl]oxymethyl]oxirane (PubChem CID 153495884) has the molecular formula C35H48O8 and a molecular weight of 596.76 g/mol. Its IUPAC name is 2-[[1-butoxy-3-[4-[2-[4-[3-but-2-ynoxy-2-(oxiran-2-ylmethoxy)propoxy]phenyl]propan-2-yl]phenoxy]propan-2-yl]oxymethyl]oxirane.
| Compound Name | 2-[[1-butoxy-3-[4-[2-[4-[3-but-2-ynoxy-2-(oxiran-2-ylmethoxy)propoxy]phenyl]propan-2-yl]phenoxy]propan-2-yl]oxymethyl]oxirane |
|---|---|
| PubChem CID | 153495884 |
| Molecular Formula | C35H48O8 |
| Molecular Weight | 596.76 g/mol |
| Exact Mass | 596.33 |
| IUPAC Name | 2-[[1-butoxy-3-[4-[2-[4-[3-but-2-ynoxy-2-(oxiran-2-ylmethoxy)propoxy]phenyl]propan-2-yl]phenoxy]propan-2-yl]oxymethyl]oxirane |
| SMILES | CC#CCOCC(COc1ccc(C(C)(C)c2ccc(OCC(COCCCC)OCC3CO3)cc2)cc1)OCC1CO1 |
| InChI | InChI=1S/C35H48O8/c1-5-7-17-36-19-31(40-23-33-25-42-33)21-38-29-13-9-27(10-14-29)35(3,4)28-11-15-30(16-12-28)39-22-32(20-37-18-8-6-2)41-24-34-26-43-34/h9-16,31-34H,5,7,17-26H2,1-4H3 |
| InChIKey | NZEQCNMVSHNAOF-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 80.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.76 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|