C27H38O6 — CID 130393295
2-[1-[4-[2-[4-[2-(ethoxymethoxy)propoxy]phenyl]propan-2-yl]phenoxy]propan-2-yloxymethyl]oxirane (PubChem CID 130393295) has the molecular formula C27H38O6 and a molecular weight of 458.60 g/mol. Its IUPAC name is 2-[1-[4-[2-[4-[2-(ethoxymethoxy)propoxy]phenyl]propan-2-yl]phenoxy]propan-2-yloxymethyl]oxirane.
| Compound Name | 2-[1-[4-[2-[4-[2-(ethoxymethoxy)propoxy]phenyl]propan-2-yl]phenoxy]propan-2-yloxymethyl]oxirane |
|---|---|
| PubChem CID | 130393295 |
| Molecular Formula | C27H38O6 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.27 |
| IUPAC Name | 2-[1-[4-[2-[4-[2-(ethoxymethoxy)propoxy]phenyl]propan-2-yl]phenoxy]propan-2-yloxymethyl]oxirane |
| SMILES | CCOCOC(C)COc1ccc(C(C)(C)c2ccc(OCC(C)OCC3CO3)cc2)cc1 |
| InChI | InChI=1S/C27H38O6/c1-6-28-19-33-21(3)16-31-25-13-9-23(10-14-25)27(4,5)22-7-11-24(12-8-22)30-15-20(2)29-17-26-18-32-26/h7-14,20-21,26H,6,15-19H2,1-5H3 |
| InChIKey | XORATOBXQXSATN-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|