C16H24O3 — CID 156746922
2-[1-(4-propan-2-ylphenoxy)butan-2-yloxymethyl]oxirane (PubChem CID 156746922) has the molecular formula C16H24O3 and a molecular weight of 264.37 g/mol. Its IUPAC name is 2-[1-(4-propan-2-ylphenoxy)butan-2-yloxymethyl]oxirane.
| Compound Name | 2-[1-(4-propan-2-ylphenoxy)butan-2-yloxymethyl]oxirane |
|---|---|
| PubChem CID | 156746922 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 2-[1-(4-propan-2-ylphenoxy)butan-2-yloxymethyl]oxirane |
| SMILES | CCC(COc1ccc(C(C)C)cc1)OCC1CO1 |
| InChI | InChI=1S/C16H24O3/c1-4-14(17-10-16-11-19-16)9-18-15-7-5-13(6-8-15)12(2)3/h5-8,12,14,16H,4,9-11H2,1-3H3 |
| InChIKey | FZKCPOKHBDYSCO-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|