C12H5F5O3S — CID 63335962
3-[(2,3,4,5,6-pentafluorophenyl)methoxy]thiophene-2-carboxylic acid (PubChem CID 63335962) has the molecular formula C12H5F5O3S and a molecular weight of 324.23 g/mol. Its IUPAC name is 3-[(2,3,4,5,6-pentafluorophenyl)methoxy]thiophene-2-carboxylic acid.
| Compound Name | 3-[(2,3,4,5,6-pentafluorophenyl)methoxy]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 63335962 |
| Molecular Formula | C12H5F5O3S |
| Molecular Weight | 324.23 g/mol |
| Exact Mass | 323.99 |
| IUPAC Name | 3-[(2,3,4,5,6-pentafluorophenyl)methoxy]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1sccc1OCc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C12H5F5O3S/c13-6-4(7(14)9(16)10(17)8(6)15)3-20-5-1-2-21-11(5)12(18)19/h1-2H,3H2,(H,18,19) |
| InChIKey | SGBYHXQYGROBTP-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.23 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|