C8H7ClO3S — CID 77012059
3-(3-chloroprop-2-enoxy)thiophene-2-carboxylic acid (PubChem CID 77012059) has the molecular formula C8H7ClO3S and a molecular weight of 218.66 g/mol. Its IUPAC name is 3-(3-chloroprop-2-enoxy)thiophene-2-carboxylic acid.
| Compound Name | 3-(3-chloroprop-2-enoxy)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 77012059 |
| Molecular Formula | C8H7ClO3S |
| Molecular Weight | 218.66 g/mol |
| Exact Mass | 217.98 |
| IUPAC Name | 3-(3-chloroprop-2-enoxy)thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1sccc1OCC=CCl |
| InChI | InChI=1S/C8H7ClO3S/c9-3-1-4-12-6-2-5-13-7(6)8(10)11/h1-3,5H,4H2,(H,10,11) |
| InChIKey | BECUJIWKXCYUAD-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.66 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |