About 2-thiophen-2-ylethyl 2-(prop-2-enylamino)acetate
2-thiophen-2-ylethyl 2-(prop-2-enylamino)acetate (PubChem CID 79275664) has the molecular formula C11H15NO2S
and a molecular weight of 225.31 g/mol. Its IUPAC name is 2-thiophen-2-ylethyl 2-(prop-2-enylamino)acetate.
Molecular Properties
| Compound Name | 2-thiophen-2-ylethyl 2-(prop-2-enylamino)acetate |
| PubChem CID | 79275664 |
| Molecular Formula | C11H15NO2S |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | 2-thiophen-2-ylethyl 2-(prop-2-enylamino)acetate |
| SMILES | C=CCNCC(=O)OCCc1cccs1 |
| InChI | InChI=1S/C11H15NO2S/c1-2-6-12-9-11(13)14-7-5-10-4-3-8-15-10/h2-4,8,12H,1,5-7,9H2 |
| InChIKey | BQZQFMZPGLGQDF-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-thiophen-2-ylethyl 2-(prop-2-enylamino)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-thiophen-2-ylethyl 2-(prop-2-enylamino)acetate?
The IUPAC name of 2-thiophen-2-ylethyl 2-(prop-2-enylamino)acetate (CID 79275664) is 2-thiophen-2-ylethyl 2-(prop-2-enylamino)acetate.
What is the SMILES notation for 2-thiophen-2-ylethyl 2-(prop-2-enylamino)acetate?
The canonical SMILES for 2-thiophen-2-ylethyl 2-(prop-2-enylamino)acetate is C=CCNCC(=O)OCCc1cccs1.
What is the InChIKey of 2-thiophen-2-ylethyl 2-(prop-2-enylamino)acetate?
The InChIKey is BQZQFMZPGLGQDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2S/c1-2-6-12-9-11(13)14-7-5-10-4-3-8-15-10/h2-4,8,12H,1,5-7,9H2.
What are the key properties of 2-thiophen-2-ylethyl 2-(prop-2-enylamino)acetate?
2-thiophen-2-ylethyl 2-(prop-2-enylamino)acetate has a molecular weight of 225.31 g/mol, XLogP of 1.61, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-thiophen-2-ylethyl 2-(prop-2-enylamino)acetate is sourced from PubChem (CID 79275664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).