About 2-phenylethyl 4-thiophen-2-ylbutanoate
2-phenylethyl 4-thiophen-2-ylbutanoate (PubChem CID 78830677) has the molecular formula C16H18O2S
and a molecular weight of 274.38 g/mol. Its IUPAC name is 2-phenylethyl 4-thiophen-2-ylbutanoate.
Molecular Properties
| Compound Name | 2-phenylethyl 4-thiophen-2-ylbutanoate |
| PubChem CID | 78830677 |
| Molecular Formula | C16H18O2S |
| Molecular Weight | 274.38 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 2-phenylethyl 4-thiophen-2-ylbutanoate |
| SMILES | O=C(CCCc1cccs1)OCCc1ccccc1 |
| InChI | InChI=1S/C16H18O2S/c17-16(10-4-8-15-9-5-13-19-15)18-12-11-14-6-2-1-3-7-14/h1-3,5-7,9,13H,4,8,10-12H2 |
| InChIKey | KYACMKLDJYWBKL-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.38 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-phenylethyl 4-thiophen-2-ylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylethyl 4-thiophen-2-ylbutanoate?
The IUPAC name of 2-phenylethyl 4-thiophen-2-ylbutanoate (CID 78830677) is 2-phenylethyl 4-thiophen-2-ylbutanoate.
What is the SMILES notation for 2-phenylethyl 4-thiophen-2-ylbutanoate?
The canonical SMILES for 2-phenylethyl 4-thiophen-2-ylbutanoate is O=C(CCCc1cccs1)OCCc1ccccc1.
What is the InChIKey of 2-phenylethyl 4-thiophen-2-ylbutanoate?
The InChIKey is KYACMKLDJYWBKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18O2S/c17-16(10-4-8-15-9-5-13-19-15)18-12-11-14-6-2-1-3-7-14/h1-3,5-7,9,13H,4,8,10-12H2.
What are the key properties of 2-phenylethyl 4-thiophen-2-ylbutanoate?
2-phenylethyl 4-thiophen-2-ylbutanoate has a molecular weight of 274.38 g/mol, XLogP of 3.86, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylethyl 4-thiophen-2-ylbutanoate is sourced from PubChem (CID 78830677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).