C11H17NO3S — CID 66000795
2-thiophen-2-ylethyl 4-amino-3-hydroxy-3-methylbutanoate (PubChem CID 66000795) has the molecular formula C11H17NO3S and a molecular weight of 243.33 g/mol. Its IUPAC name is 2-thiophen-2-ylethyl 4-amino-3-hydroxy-3-methylbutanoate.
| Compound Name | 2-thiophen-2-ylethyl 4-amino-3-hydroxy-3-methylbutanoate |
|---|---|
| PubChem CID | 66000795 |
| Molecular Formula | C11H17NO3S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 2-thiophen-2-ylethyl 4-amino-3-hydroxy-3-methylbutanoate |
| SMILES | CC(O)(CN)CC(=O)OCCc1cccs1 |
| InChI | InChI=1S/C11H17NO3S/c1-11(14,8-12)7-10(13)15-5-4-9-3-2-6-16-9/h2-3,6,14H,4-5,7-8,12H2,1H3 |
| InChIKey | IGLHWIADONFFRR-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |