C14H21NO2S — CID 54966664
2-thiophen-2-ylethyl 2-amino-2-cyclohexylacetate (PubChem CID 54966664) has the molecular formula C14H21NO2S and a molecular weight of 267.39 g/mol. Its IUPAC name is 2-thiophen-2-ylethyl 2-amino-2-cyclohexylacetate.
| Compound Name | 2-thiophen-2-ylethyl 2-amino-2-cyclohexylacetate |
|---|---|
| PubChem CID | 54966664 |
| Molecular Formula | C14H21NO2S |
| Molecular Weight | 267.39 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 2-thiophen-2-ylethyl 2-amino-2-cyclohexylacetate |
| SMILES | NC(C(=O)OCCc1cccs1)C1CCCCC1 |
| InChI | InChI=1S/C14H21NO2S/c15-13(11-5-2-1-3-6-11)14(16)17-9-8-12-7-4-10-18-12/h4,7,10-11,13H,1-3,5-6,8-9,15H2 |
| InChIKey | CMKOYHUSFDRPFB-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.39 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |