C11H19ClN2OS — CID 119289696
2-amino-N-propan-2-yl-N-(thiophen-2-ylmethyl)propanamide;hydrochloride (PubChem CID 119289696) has the molecular formula C11H19ClN2OS and a molecular weight of 262.81 g/mol. Its IUPAC name is 2-amino-N-propan-2-yl-N-(thiophen-2-ylmethyl)propanamide;hydrochloride.
| Compound Name | 2-amino-N-propan-2-yl-N-(thiophen-2-ylmethyl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 119289696 |
| Molecular Formula | C11H19ClN2OS |
| Molecular Weight | 262.81 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 2-amino-N-propan-2-yl-N-(thiophen-2-ylmethyl)propanamide;hydrochloride |
| SMILES | CC(N)C(=O)N(Cc1cccs1)C(C)C.Cl |
| InChI | InChI=1S/C11H18N2OS.ClH/c1-8(2)13(11(14)9(3)12)7-10-5-4-6-15-10;/h4-6,8-9H,7,12H2,1-3H3;1H |
| InChIKey | DNQURQYOADZDBX-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.81 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |