C14H24N2OS — CID 79814434
2-amino-2-ethyl-N-propan-2-yl-N-(thiophen-2-ylmethyl)butanamide (PubChem CID 79814434) has the molecular formula C14H24N2OS and a molecular weight of 268.43 g/mol. Its IUPAC name is 2-amino-2-ethyl-N-propan-2-yl-N-(thiophen-2-ylmethyl)butanamide.
| Compound Name | 2-amino-2-ethyl-N-propan-2-yl-N-(thiophen-2-ylmethyl)butanamide |
|---|---|
| PubChem CID | 79814434 |
| Molecular Formula | C14H24N2OS |
| Molecular Weight | 268.43 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 2-amino-2-ethyl-N-propan-2-yl-N-(thiophen-2-ylmethyl)butanamide |
| SMILES | CCC(N)(CC)C(=O)N(Cc1cccs1)C(C)C |
| InChI | InChI=1S/C14H24N2OS/c1-5-14(15,6-2)13(17)16(11(3)4)10-12-8-7-9-18-12/h7-9,11H,5-6,10,15H2,1-4H3 |
| InChIKey | FDGCYQDQZLOYQP-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.43 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |