C15H22ClNO3S — CID 116537844
ethyl 2-[(5-chlorothiophen-2-yl)methyl-methylcarbamoyl]-3,3-dimethylbutanoate (PubChem CID 116537844) has the molecular formula C15H22ClNO3S and a molecular weight of 331.87 g/mol. Its IUPAC name is ethyl 2-[(5-chlorothiophen-2-yl)methyl-methylcarbamoyl]-3,3-dimethylbutanoate.
| Compound Name | ethyl 2-[(5-chlorothiophen-2-yl)methyl-methylcarbamoyl]-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 116537844 |
| Molecular Formula | C15H22ClNO3S |
| Molecular Weight | 331.87 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | ethyl 2-[(5-chlorothiophen-2-yl)methyl-methylcarbamoyl]-3,3-dimethylbutanoate |
| SMILES | CCOC(=O)C(C(=O)N(C)Cc1ccc(Cl)s1)C(C)(C)C |
| InChI | InChI=1S/C15H22ClNO3S/c1-6-20-14(19)12(15(2,3)4)13(18)17(5)9-10-7-8-11(16)21-10/h7-8,12H,6,9H2,1-5H3 |
| InChIKey | SRMZHZCPAGOXEX-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.87 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|