C12H19ClN2O2S — CID 81083116
2-amino-N-[(5-chlorothiophen-2-yl)methyl]-5-methoxy-N-methylpentanamide (PubChem CID 81083116) has the molecular formula C12H19ClN2O2S and a molecular weight of 290.82 g/mol. Its IUPAC name is 2-amino-N-[(5-chlorothiophen-2-yl)methyl]-5-methoxy-N-methylpentanamide.
| Compound Name | 2-amino-N-[(5-chlorothiophen-2-yl)methyl]-5-methoxy-N-methylpentanamide |
|---|---|
| PubChem CID | 81083116 |
| Molecular Formula | C12H19ClN2O2S |
| Molecular Weight | 290.82 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 2-amino-N-[(5-chlorothiophen-2-yl)methyl]-5-methoxy-N-methylpentanamide |
| SMILES | COCCCC(N)C(=O)N(C)Cc1ccc(Cl)s1 |
| InChI | InChI=1S/C12H19ClN2O2S/c1-15(8-9-5-6-11(13)18-9)12(16)10(14)4-3-7-17-2/h5-6,10H,3-4,7-8,14H2,1-2H3 |
| InChIKey | WCIIJOOSILABMJ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.82 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|