C12H15ClO2S — CID 20542836
ethyl 2-[(4-chlorophenyl)methylsulfanyl]propanoate (PubChem CID 20542836) has the molecular formula C12H15ClO2S and a molecular weight of 258.77 g/mol. Its IUPAC name is ethyl 2-[(4-chlorophenyl)methylsulfanyl]propanoate.
| Compound Name | ethyl 2-[(4-chlorophenyl)methylsulfanyl]propanoate |
|---|---|
| PubChem CID | 20542836 |
| Molecular Formula | C12H15ClO2S |
| Molecular Weight | 258.77 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | ethyl 2-[(4-chlorophenyl)methylsulfanyl]propanoate |
| SMILES | CCOC(=O)C(C)SCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H15ClO2S/c1-3-15-12(14)9(2)16-8-10-4-6-11(13)7-5-10/h4-7,9H,3,8H2,1-2H3 |
| InChIKey | HJQRTTGFHOTIED-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.77 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |