C16H12N2O6 — CID 24557569
[2-(furan-2-carbonylamino)-2-oxoethyl] 2-(4-cyanophenoxy)acetate (PubChem CID 24557569) has the molecular formula C16H12N2O6 and a molecular weight of 328.28 g/mol. Its IUPAC name is [2-(furan-2-carbonylamino)-2-oxoethyl] 2-(4-cyanophenoxy)acetate.
| Compound Name | [2-(furan-2-carbonylamino)-2-oxoethyl] 2-(4-cyanophenoxy)acetate |
|---|---|
| PubChem CID | 24557569 |
| Molecular Formula | C16H12N2O6 |
| Molecular Weight | 328.28 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | [2-(furan-2-carbonylamino)-2-oxoethyl] 2-(4-cyanophenoxy)acetate |
| SMILES | N#Cc1ccc(OCC(=O)OCC(=O)NC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C16H12N2O6/c17-8-11-3-5-12(6-4-11)23-10-15(20)24-9-14(19)18-16(21)13-2-1-7-22-13/h1-7H,9-10H2,(H,18,19,21) |
| InChIKey | IEMWMEZMDWBJLD-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 118.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.28 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |