C18H19Cl2N3O5 — CID 4797350
[2-[(2,4-dichlorophenyl)methylamino]-2-oxoethyl] 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate (PubChem CID 4797350) has the molecular formula C18H19Cl2N3O5 and a molecular weight of 428.27 g/mol. Its IUPAC name is [2-[(2,4-dichlorophenyl)methylamino]-2-oxoethyl] 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate.
| Compound Name | [2-[(2,4-dichlorophenyl)methylamino]-2-oxoethyl] 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate |
|---|---|
| PubChem CID | 4797350 |
| Molecular Formula | C18H19Cl2N3O5 |
| Molecular Weight | 428.27 g/mol |
| Exact Mass | 427.07 |
| IUPAC Name | [2-[(2,4-dichlorophenyl)methylamino]-2-oxoethyl] 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate |
| SMILES | O=C(COC(=O)CN1C(=O)NC2(CCCC2)C1=O)NCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H19Cl2N3O5/c19-12-4-3-11(13(20)7-12)8-21-14(24)10-28-15(25)9-23-16(26)18(22-17(23)27)5-1-2-6-18/h3-4,7H,1-2,5-6,8-10H2,(H,21,24)(H,22,27) |
| InChIKey | XIHVFNWAXUSTFH-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.27 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|