C21H26N2O7 — CID 5217288
ethyl 4-[2-[2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetyl]oxyacetyl]-2,5-dimethyl-1H-pyrrole-3-carboxylate (PubChem CID 5217288) has the molecular formula C21H26N2O7 and a molecular weight of 418.45 g/mol. Its IUPAC name is ethyl 4-[2-[2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetyl]oxyacetyl]-2,5-dimethyl-1H-pyrrole-3-carboxylate.
| Compound Name | ethyl 4-[2-[2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetyl]oxyacetyl]-2,5-dimethyl-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 5217288 |
| Molecular Formula | C21H26N2O7 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | ethyl 4-[2-[2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetyl]oxyacetyl]-2,5-dimethyl-1H-pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)[nH]c(C)c1C(=O)COC(=O)CN1C(=O)C2CCCCC2C1=O |
| InChI | InChI=1S/C21H26N2O7/c1-4-29-21(28)18-12(3)22-11(2)17(18)15(24)10-30-16(25)9-23-19(26)13-7-5-6-8-14(13)20(23)27/h13-14,22H,4-10H2,1-3H3 |
| InChIKey | FWOBETNGGNCYIK-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 122.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|