C26H24N2O9 — CID 19645855
[4-[2-[2-(5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetyl]oxyacetyl]phenyl] 4-nitrobenzoate (PubChem CID 19645855) has the molecular formula C26H24N2O9 and a molecular weight of 508.48 g/mol. Its IUPAC name is [4-[2-[2-(5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetyl]oxyacetyl]phenyl] 4-nitrobenzoate.
| Compound Name | [4-[2-[2-(5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetyl]oxyacetyl]phenyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 19645855 |
| Molecular Formula | C26H24N2O9 |
| Molecular Weight | 508.48 g/mol |
| Exact Mass | 508.15 |
| IUPAC Name | [4-[2-[2-(5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetyl]oxyacetyl]phenyl] 4-nitrobenzoate |
| SMILES | CC1CCC2C(=O)N(CC(=O)OCC(=O)c3ccc(OC(=O)c4ccc([N+](=O)[O-])cc4)cc3)C(=O)C2C1 |
| InChI | InChI=1S/C26H24N2O9/c1-15-2-11-20-21(12-15)25(32)27(24(20)31)13-23(30)36-14-22(29)16-5-9-19(10-6-16)37-26(33)17-3-7-18(8-4-17)28(34)35/h3-10,15,20-21H,2,11-14H2,1H3 |
| InChIKey | KOVVOOKKWUTXDG-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 150.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.48 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|