C23H22BrNO4 — CID 6595539
(3aR,5S,7aS)-2-[3-[2-(4-bromophenyl)-2-oxoethoxy]phenyl]-5-methyl-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione (PubChem CID 6595539) has the molecular formula C23H22BrNO4 and a molecular weight of 456.34 g/mol. Its IUPAC name is (3aR,5S,7aS)-2-[3-[2-(4-bromophenyl)-2-oxoethoxy]phenyl]-5-methyl-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione.
| Compound Name | (3aR,5S,7aS)-2-[3-[2-(4-bromophenyl)-2-oxoethoxy]phenyl]-5-methyl-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 6595539 |
| Molecular Formula | C23H22BrNO4 |
| Molecular Weight | 456.34 g/mol |
| Exact Mass | 455.07 |
| IUPAC Name | (3aR,5S,7aS)-2-[3-[2-(4-bromophenyl)-2-oxoethoxy]phenyl]-5-methyl-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
| SMILES | C[C@H]1CC[C@@H]2C(=O)N(c3cccc(OCC(=O)c4ccc(Br)cc4)c3)C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C23H22BrNO4/c1-14-5-10-19-20(11-14)23(28)25(22(19)27)17-3-2-4-18(12-17)29-13-21(26)15-6-8-16(24)9-7-15/h2-4,6-9,12,14,19-20H,5,10-11,13H2,1H3/t14-,19-,20+/m0/s1 |
| InChIKey | ZZUYSBIPQNGZFH-PNHOKKKMSA-N |
| XLogP | 4.64 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.34 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|