C25H25NO5 — CID 92543042
(2-acetyl-4-methylphenyl) 3-[(3aS,5S,7aR)-5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]benzoate (PubChem CID 92543042) has the molecular formula C25H25NO5 and a molecular weight of 419.48 g/mol. Its IUPAC name is (2-acetyl-4-methylphenyl) 3-[(3aS,5S,7aR)-5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]benzoate.
| Compound Name | (2-acetyl-4-methylphenyl) 3-[(3aS,5S,7aR)-5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]benzoate |
|---|---|
| PubChem CID | 92543042 |
| Molecular Formula | C25H25NO5 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | (2-acetyl-4-methylphenyl) 3-[(3aS,5S,7aR)-5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]benzoate |
| SMILES | CC(=O)c1cc(C)ccc1OC(=O)c1cccc(N2C(=O)[C@H]3C[C@@H](C)CC[C@H]3C2=O)c1 |
| InChI | InChI=1S/C25H25NO5/c1-14-7-9-19-21(12-14)24(29)26(23(19)28)18-6-4-5-17(13-18)25(30)31-22-10-8-15(2)11-20(22)16(3)27/h4-6,8,10-11,13-14,19,21H,7,9,12H2,1-3H3/t14-,19+,21-/m0/s1 |
| InChIKey | YGMRETPRTFWPOO-ZKYUUJBMSA-N |
| XLogP | 4.34 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|