C29H27NO4 — CID 124580220
(2,4-dimethylphenyl) 3-[(3aS,5R,7aR)-1,3-dioxo-5-phenyl-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]benzoate (PubChem CID 124580220) has the molecular formula C29H27NO4 and a molecular weight of 453.54 g/mol. Its IUPAC name is (2,4-dimethylphenyl) 3-[(3aS,5R,7aR)-1,3-dioxo-5-phenyl-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]benzoate.
| Compound Name | (2,4-dimethylphenyl) 3-[(3aS,5R,7aR)-1,3-dioxo-5-phenyl-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]benzoate |
|---|---|
| PubChem CID | 124580220 |
| Molecular Formula | C29H27NO4 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | (2,4-dimethylphenyl) 3-[(3aS,5R,7aR)-1,3-dioxo-5-phenyl-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]benzoate |
| SMILES | Cc1ccc(OC(=O)c2cccc(N3C(=O)[C@H]4C[C@H](c5ccccc5)CC[C@H]4C3=O)c2)c(C)c1 |
| InChI | InChI=1S/C29H27NO4/c1-18-11-14-26(19(2)15-18)34-29(33)22-9-6-10-23(16-22)30-27(31)24-13-12-21(17-25(24)28(30)32)20-7-4-3-5-8-20/h3-11,14-16,21,24-25H,12-13,17H2,1-2H3/t21-,24-,25+/m1/s1 |
| InChIKey | DZUUQLJEPQSGLU-SDUSCBPUSA-N |
| XLogP | 5.60 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|