C30H27ClN2O5 — CID 124716394
[2-(3-chloro-4-methylanilino)-2-oxoethyl] 3-[(3aR,5S,7aR)-1,3-dioxo-5-phenyl-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]benzoate (PubChem CID 124716394) has the molecular formula C30H27ClN2O5 and a molecular weight of 531.01 g/mol. Its IUPAC name is [2-(3-chloro-4-methylanilino)-2-oxoethyl] 3-[(3aR,5S,7aR)-1,3-dioxo-5-phenyl-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]benzoate.
| Compound Name | [2-(3-chloro-4-methylanilino)-2-oxoethyl] 3-[(3aR,5S,7aR)-1,3-dioxo-5-phenyl-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]benzoate |
|---|---|
| PubChem CID | 124716394 |
| Molecular Formula | C30H27ClN2O5 |
| Molecular Weight | 531.01 g/mol |
| Exact Mass | 530.16 |
| IUPAC Name | [2-(3-chloro-4-methylanilino)-2-oxoethyl] 3-[(3aR,5S,7aR)-1,3-dioxo-5-phenyl-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]benzoate |
| SMILES | Cc1ccc(NC(=O)COC(=O)c2cccc(N3C(=O)[C@@H]4CC[C@H](c5ccccc5)C[C@H]4C3=O)c2)cc1Cl |
| InChI | InChI=1S/C30H27ClN2O5/c1-18-10-12-22(16-26(18)31)32-27(34)17-38-30(37)21-8-5-9-23(14-21)33-28(35)24-13-11-20(15-25(24)29(33)36)19-6-3-2-4-7-19/h2-10,12,14,16,20,24-25H,11,13,15,17H2,1H3,(H,32,34)/t20-,24+,25+/m0/s1 |
| InChIKey | SATBFUHEXPNMBB-BUUDZMLXSA-N |
| XLogP | 5.52 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.01 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|