C30H28N2O3 — CID 98338341
N-(3,5-dimethylphenyl)-3-[(1R,2R,6S,7R,8R)-3,5-dioxo-8-phenyl-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzamide (PubChem CID 98338341) has the molecular formula C30H28N2O3 and a molecular weight of 464.57 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-3-[(1R,2R,6S,7R,8R)-3,5-dioxo-8-phenyl-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzamide.
| Compound Name | N-(3,5-dimethylphenyl)-3-[(1R,2R,6S,7R,8R)-3,5-dioxo-8-phenyl-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzamide |
|---|---|
| PubChem CID | 98338341 |
| Molecular Formula | C30H28N2O3 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | N-(3,5-dimethylphenyl)-3-[(1R,2R,6S,7R,8R)-3,5-dioxo-8-phenyl-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzamide |
| SMILES | Cc1cc(C)cc(NC(=O)c2cccc(N3C(=O)[C@@H]4[C@@H]5C[C@@H]([C@@H]4C3=O)[C@H](c3ccccc3)C5)c2)c1 |
| InChI | InChI=1S/C30H28N2O3/c1-17-11-18(2)13-22(12-17)31-28(33)20-9-6-10-23(14-20)32-29(34)26-21-15-24(19-7-4-3-5-8-19)25(16-21)27(26)30(32)35/h3-14,21,24-27H,15-16H2,1-2H3,(H,31,33)/t21-,24-,25+,26+,27-/m0/s1 |
| InChIKey | KCHDVIINTSGJCS-ZYMCBDGHSA-N |
| XLogP | 5.48 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|