C22H18Br2N2O3 — CID 98164622
3-[(1S,2R,6R,7S,8R,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-N-phenylbenzamide (PubChem CID 98164622) has the molecular formula C22H18Br2N2O3 and a molecular weight of 518.21 g/mol. Its IUPAC name is 3-[(1S,2R,6R,7S,8R,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-N-phenylbenzamide.
| Compound Name | 3-[(1S,2R,6R,7S,8R,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-N-phenylbenzamide |
|---|---|
| PubChem CID | 98164622 |
| Molecular Formula | C22H18Br2N2O3 |
| Molecular Weight | 518.21 g/mol |
| Exact Mass | 515.97 |
| IUPAC Name | 3-[(1S,2R,6R,7S,8R,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-N-phenylbenzamide |
| SMILES | O=C(Nc1ccccc1)c1cccc(N2C(=O)[C@H]3[C@@H]4C[C@H]([C@@H](Br)[C@H]4Br)[C@@H]3C2=O)c1 |
| InChI | InChI=1S/C22H18Br2N2O3/c23-18-14-10-15(19(18)24)17-16(14)21(28)26(22(17)29)13-8-4-5-11(9-13)20(27)25-12-6-2-1-3-7-12/h1-9,14-19H,10H2,(H,25,27)/t14-,15-,16-,17-,18-,19+/m0/s1 |
| InChIKey | QIMHZLSMQJAKQU-KOUJMVCDSA-N |
| XLogP | 4.22 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.21 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|