C32H29NO5 — CID 124769672
[(2S)-1-(4-methylphenyl)-1-oxopropan-2-yl] 3-[(1R,2R,6S,7R,8R)-3,5-dioxo-8-phenyl-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzoate (PubChem CID 124769672) has the molecular formula C32H29NO5 and a molecular weight of 507.59 g/mol. Its IUPAC name is [(2S)-1-(4-methylphenyl)-1-oxopropan-2-yl] 3-[(1R,2R,6S,7R,8R)-3,5-dioxo-8-phenyl-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzoate.
| Compound Name | [(2S)-1-(4-methylphenyl)-1-oxopropan-2-yl] 3-[(1R,2R,6S,7R,8R)-3,5-dioxo-8-phenyl-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzoate |
|---|---|
| PubChem CID | 124769672 |
| Molecular Formula | C32H29NO5 |
| Molecular Weight | 507.59 g/mol |
| Exact Mass | 507.20 |
| IUPAC Name | [(2S)-1-(4-methylphenyl)-1-oxopropan-2-yl] 3-[(1R,2R,6S,7R,8R)-3,5-dioxo-8-phenyl-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzoate |
| SMILES | Cc1ccc(C(=O)[C@H](C)OC(=O)c2cccc(N3C(=O)[C@@H]4[C@@H]5C[C@@H]([C@@H]4C3=O)[C@H](c3ccccc3)C5)c2)cc1 |
| InChI | InChI=1S/C32H29NO5/c1-18-11-13-21(14-12-18)29(34)19(2)38-32(37)22-9-6-10-24(15-22)33-30(35)27-23-16-25(20-7-4-3-5-8-20)26(17-23)28(27)31(33)36/h3-15,19,23,25-28H,16-17H2,1-2H3/t19-,23-,25-,26+,27+,28-/m0/s1 |
| InChIKey | UPCAJFGBNCWKCO-RTSCKOAKSA-N |
| XLogP | 5.35 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.59 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|