C24H22BrClN2O3 — CID 98106759
N-(4-bromo-5-chloro-2-methylphenyl)-2-[(1R,2R,6S,7R,8S)-3,5-dioxo-8-phenyl-4-azatricyclo[5.2.1.02,6]decan-4-yl]acetamide (PubChem CID 98106759) has the molecular formula C24H22BrClN2O3 and a molecular weight of 501.81 g/mol. Its IUPAC name is N-(4-bromo-5-chloro-2-methylphenyl)-2-[(1R,2R,6S,7R,8S)-3,5-dioxo-8-phenyl-4-azatricyclo[5.2.1.02,6]decan-4-yl]acetamide.
| Compound Name | N-(4-bromo-5-chloro-2-methylphenyl)-2-[(1R,2R,6S,7R,8S)-3,5-dioxo-8-phenyl-4-azatricyclo[5.2.1.02,6]decan-4-yl]acetamide |
|---|---|
| PubChem CID | 98106759 |
| Molecular Formula | C24H22BrClN2O3 |
| Molecular Weight | 501.81 g/mol |
| Exact Mass | 500.05 |
| IUPAC Name | N-(4-bromo-5-chloro-2-methylphenyl)-2-[(1R,2R,6S,7R,8S)-3,5-dioxo-8-phenyl-4-azatricyclo[5.2.1.02,6]decan-4-yl]acetamide |
| SMILES | Cc1cc(Br)c(Cl)cc1NC(=O)CN1C(=O)[C@@H]2[C@@H]3C[C@@H]([C@@H]2C1=O)[C@@H](c1ccccc1)C3 |
| InChI | InChI=1S/C24H22BrClN2O3/c1-12-7-17(25)18(26)10-19(12)27-20(29)11-28-23(30)21-14-8-15(13-5-3-2-4-6-13)16(9-14)22(21)24(28)31/h2-7,10,14-16,21-22H,8-9,11H2,1H3,(H,27,29)/t14-,15+,16+,21+,22-/m0/s1 |
| InChIKey | GHMLOAUJNIAWRA-TVYSTNIMSA-N |
| XLogP | 4.77 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.81 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|