C19H21BrN2O3 — CID 18554771
N-(4-bromo-2,5-dimethylphenyl)-2-[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]acetamide (PubChem CID 18554771) has the molecular formula C19H21BrN2O3 and a molecular weight of 405.29 g/mol. Its IUPAC name is N-(4-bromo-2,5-dimethylphenyl)-2-[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]acetamide.
| Compound Name | N-(4-bromo-2,5-dimethylphenyl)-2-[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]acetamide |
|---|---|
| PubChem CID | 18554771 |
| Molecular Formula | C19H21BrN2O3 |
| Molecular Weight | 405.29 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | N-(4-bromo-2,5-dimethylphenyl)-2-[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]acetamide |
| SMILES | Cc1cc(NC(=O)CN2C(=O)[C@@H]3[C@@H]4CC[C@H](C4)[C@@H]3C2=O)c(C)cc1Br |
| InChI | InChI=1S/C19H21BrN2O3/c1-9-6-14(10(2)5-13(9)20)21-15(23)8-22-18(24)16-11-3-4-12(7-11)17(16)19(22)25/h5-6,11-12,16-17H,3-4,7-8H2,1-2H3,(H,21,23)/t11-,12-,16-,17+/m1/s1 |
| InChIKey | JDYWDKYMZSKHCU-SKNMWMDOSA-N |
| XLogP | 3.04 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.29 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|