C26H18ClFN4OS — CID 2379084
2-(2-chlorophenyl)-N-[2-cyanoethyl-(2-fluorophenyl)carbamothioyl]quinoline-4-carboxamide (PubChem CID 2379084) has the molecular formula C26H18ClFN4OS and a molecular weight of 488.98 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-N-[2-cyanoethyl-(2-fluorophenyl)carbamothioyl]quinoline-4-carboxamide.
| Compound Name | 2-(2-chlorophenyl)-N-[2-cyanoethyl-(2-fluorophenyl)carbamothioyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 2379084 |
| Molecular Formula | C26H18ClFN4OS |
| Molecular Weight | 488.98 g/mol |
| Exact Mass | 488.09 |
| IUPAC Name | 2-(2-chlorophenyl)-N-[2-cyanoethyl-(2-fluorophenyl)carbamothioyl]quinoline-4-carboxamide |
| SMILES | N#CCCN(C(=S)NC(=O)c1cc(-c2ccccc2Cl)nc2ccccc12)c1ccccc1F |
| InChI | InChI=1S/C26H18ClFN4OS/c27-20-10-3-1-9-18(20)23-16-19(17-8-2-5-12-22(17)30-23)25(33)31-26(34)32(15-7-14-29)24-13-6-4-11-21(24)28/h1-6,8-13,16H,7,15H2,(H,31,33,34) |
| InChIKey | CXYOKXOSLGDRHQ-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 69.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.98 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|