C16H33N3O2S2 — CID 172594400
N-[2-[2-[3-[ethyl(methyl)amino]propanoylamino]ethyldisulfanyl]ethyl]-4-methylpentanamide (PubChem CID 172594400) has the molecular formula C16H33N3O2S2 and a molecular weight of 363.59 g/mol. Its IUPAC name is N-[2-[2-[3-[ethyl(methyl)amino]propanoylamino]ethyldisulfanyl]ethyl]-4-methylpentanamide.
| Compound Name | N-[2-[2-[3-[ethyl(methyl)amino]propanoylamino]ethyldisulfanyl]ethyl]-4-methylpentanamide |
|---|---|
| PubChem CID | 172594400 |
| Molecular Formula | C16H33N3O2S2 |
| Molecular Weight | 363.59 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | N-[2-[2-[3-[ethyl(methyl)amino]propanoylamino]ethyldisulfanyl]ethyl]-4-methylpentanamide |
| SMILES | CCN(C)CCC(=O)NCCSSCCNC(=O)CCC(C)C |
| InChI | InChI=1S/C16H33N3O2S2/c1-5-19(4)11-8-16(21)18-10-13-23-22-12-9-17-15(20)7-6-14(2)3/h14H,5-13H2,1-4H3,(H,17,20)(H,18,21) |
| InChIKey | MPAMSIUORJSETA-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.59 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|