C16H34N2O2 — CID 134502890
3-methyl-N-(3-methylbutyl)-3-[3-methyl-3-(methylamino)butoxy]butanamide (PubChem CID 134502890) has the molecular formula C16H34N2O2 and a molecular weight of 286.46 g/mol. Its IUPAC name is 3-methyl-N-(3-methylbutyl)-3-[3-methyl-3-(methylamino)butoxy]butanamide.
| Compound Name | 3-methyl-N-(3-methylbutyl)-3-[3-methyl-3-(methylamino)butoxy]butanamide |
|---|---|
| PubChem CID | 134502890 |
| Molecular Formula | C16H34N2O2 |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.26 |
| IUPAC Name | 3-methyl-N-(3-methylbutyl)-3-[3-methyl-3-(methylamino)butoxy]butanamide |
| SMILES | CNC(C)(C)CCOC(C)(C)CC(=O)NCCC(C)C |
| InChI | InChI=1S/C16H34N2O2/c1-13(2)8-10-18-14(19)12-16(5,6)20-11-9-15(3,4)17-7/h13,17H,8-12H2,1-7H3,(H,18,19) |
| InChIKey | CMRJCUIHQLAHCP-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |