C17H32N2O5 — CID 167219858
2-[[3-methyl-3-[3-methyl-3-(methylamino)butoxy]butanoyl]amino]-5-oxohexanoic acid (PubChem CID 167219858) has the molecular formula C17H32N2O5 and a molecular weight of 344.45 g/mol. Its IUPAC name is 2-[[3-methyl-3-[3-methyl-3-(methylamino)butoxy]butanoyl]amino]-5-oxohexanoic acid.
| Compound Name | 2-[[3-methyl-3-[3-methyl-3-(methylamino)butoxy]butanoyl]amino]-5-oxohexanoic acid |
|---|---|
| PubChem CID | 167219858 |
| Molecular Formula | C17H32N2O5 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.23 |
| IUPAC Name | 2-[[3-methyl-3-[3-methyl-3-(methylamino)butoxy]butanoyl]amino]-5-oxohexanoic acid |
| SMILES | CNC(C)(C)CCOC(C)(C)CC(=O)NC(CCC(C)=O)C(=O)O |
| InChI | InChI=1S/C17H32N2O5/c1-12(20)7-8-13(15(22)23)19-14(21)11-17(4,5)24-10-9-16(2,3)18-6/h13,18H,7-11H2,1-6H3,(H,19,21)(H,22,23) |
| InChIKey | ORHFMXPOTHKRGB-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |