C18H33NO5S — CID 166977674
S-[3-[[2-methyl-2-[3-methyl-3-(3-oxobutoxy)butoxy]propyl]amino]-3-oxopropyl] ethanethioate (PubChem CID 166977674) has the molecular formula C18H33NO5S and a molecular weight of 375.53 g/mol. Its IUPAC name is S-[3-[[2-methyl-2-[3-methyl-3-(3-oxobutoxy)butoxy]propyl]amino]-3-oxopropyl] ethanethioate.
| Compound Name | S-[3-[[2-methyl-2-[3-methyl-3-(3-oxobutoxy)butoxy]propyl]amino]-3-oxopropyl] ethanethioate |
|---|---|
| PubChem CID | 166977674 |
| Molecular Formula | C18H33NO5S |
| Molecular Weight | 375.53 g/mol |
| Exact Mass | 375.21 |
| IUPAC Name | S-[3-[[2-methyl-2-[3-methyl-3-(3-oxobutoxy)butoxy]propyl]amino]-3-oxopropyl] ethanethioate |
| SMILES | CC(=O)CCOC(C)(C)CCOC(C)(C)CNC(=O)CCSC(C)=O |
| InChI | InChI=1S/C18H33NO5S/c1-14(20)7-10-23-17(3,4)9-11-24-18(5,6)13-19-16(22)8-12-25-15(2)21/h7-13H2,1-6H3,(H,19,22) |
| InChIKey | HSVOLDLYBBCXHT-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.53 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|