About (3-methoxy-3-methylbutyl) 2-(methylamino)butanoate
(3-methoxy-3-methylbutyl) 2-(methylamino)butanoate (PubChem CID 106666081) has the molecular formula C11H23NO3
and a molecular weight of 217.31 g/mol. Its IUPAC name is (3-methoxy-3-methylbutyl) 2-(methylamino)butanoate.
Molecular Properties
| Compound Name | (3-methoxy-3-methylbutyl) 2-(methylamino)butanoate |
| PubChem CID | 106666081 |
| Molecular Formula | C11H23NO3 |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.17 |
| IUPAC Name | (3-methoxy-3-methylbutyl) 2-(methylamino)butanoate |
| SMILES | CCC(NC)C(=O)OCCC(C)(C)OC |
| InChI | InChI=1S/C11H23NO3/c1-6-9(12-4)10(13)15-8-7-11(2,3)14-5/h9,12H,6-8H2,1-5H3 |
| InChIKey | UUPBFGHZKVQBTB-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3-methoxy-3-methylbutyl) 2-(methylamino)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methoxy-3-methylbutyl) 2-(methylamino)butanoate?
The IUPAC name of (3-methoxy-3-methylbutyl) 2-(methylamino)butanoate (CID 106666081) is (3-methoxy-3-methylbutyl) 2-(methylamino)butanoate.
What is the SMILES notation for (3-methoxy-3-methylbutyl) 2-(methylamino)butanoate?
The canonical SMILES for (3-methoxy-3-methylbutyl) 2-(methylamino)butanoate is CCC(NC)C(=O)OCCC(C)(C)OC.
What is the InChIKey of (3-methoxy-3-methylbutyl) 2-(methylamino)butanoate?
The InChIKey is UUPBFGHZKVQBTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO3/c1-6-9(12-4)10(13)15-8-7-11(2,3)14-5/h9,12H,6-8H2,1-5H3.
What are the key properties of (3-methoxy-3-methylbutyl) 2-(methylamino)butanoate?
(3-methoxy-3-methylbutyl) 2-(methylamino)butanoate has a molecular weight of 217.31 g/mol, XLogP of 1.34, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methoxy-3-methylbutyl) 2-(methylamino)butanoate is sourced from PubChem (CID 106666081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).